C21H25ClN4O2 — CID 177143776
(1Z)-1-[amino-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]methylidene]-3-(4-methoxyphenyl)urea (PubChem CID 177143776) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is (1Z)-1-[amino-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]methylidene]-3-(4-methoxyphenyl)urea.
| Compound Name | (1Z)-1-[amino-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]methylidene]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 177143776 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (1Z)-1-[amino-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]methylidene]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)/N=C(\N)C2CCCN(Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-28-19-10-8-18(9-11-19)24-21(27)25-20(23)16-3-2-12-26(14-16)13-15-4-6-17(22)7-5-15/h4-11,16H,2-3,12-14H2,1H3,(H3,23,24,25,27) |
| InChIKey | CBMYLSIFSSPXEG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|