C27H29N5O4 — CID 177144047
N-[2-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]imidazo[1,2-a]pyridin-3-yl]cyclohexanecarboxamide (PubChem CID 177144047) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[2-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]imidazo[1,2-a]pyridin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]imidazo[1,2-a]pyridin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 177144047 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[2-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-5-yl]imidazo[1,2-a]pyridin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C1CCC(N2Cc3cc(-c4nc5ccccn5c4NC(=O)C4CCCCC4)ccc3C2O)C(=O)N1 |
| InChI | InChI=1S/C27H29N5O4/c33-22-12-11-20(26(35)29-22)32-15-18-14-17(9-10-19(18)27(32)36)23-24(31-13-5-4-8-21(31)28-23)30-25(34)16-6-2-1-3-7-16/h4-5,8-10,13-14,16,20,27,36H,1-3,6-7,11-12,15H2,(H,30,34)(H,29,33,35) |
| InChIKey | KZGTYSIHCFUQFU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|