C22H33NOS — CID 177144320
8-[(cyclopropylsulfanylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol (PubChem CID 177144320) has the molecular formula C22H33NOS and a molecular weight of 359.58 g/mol. Its IUPAC name is 8-[(cyclopropylsulfanylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol.
| Compound Name | 8-[(cyclopropylsulfanylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
|---|---|
| PubChem CID | 177144320 |
| Molecular Formula | C22H33NOS |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 8-[(cyclopropylsulfanylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
| SMILES | CC(C)C1=C2C3=CC=C(CNSC4CC4)CC(O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C22H33NOS/c1-14(2)17-8-10-22(3)11-9-18-19(21(17)22)7-4-15(12-20(18)24)13-23-25-16-5-6-16/h4,7,14,16,18,20,23-24H,5-6,8-13H2,1-3H3 |
| InChIKey | NSYNIPQAVRSNDD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|