C19H29NO — CID 177144134
(3aS,5aR,6S)-8-(aminomethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol (PubChem CID 177144134) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (3aS,5aR,6S)-8-(aminomethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol.
| Compound Name | (3aS,5aR,6S)-8-(aminomethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
|---|---|
| PubChem CID | 177144134 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (3aS,5aR,6S)-8-(aminomethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
| SMILES | CC(C)C1=C2C3=CC=C(CN)C[C@H](O)[C@@H]3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C19H29NO/c1-12(2)14-6-8-19(3)9-7-15-16(18(14)19)5-4-13(11-20)10-17(15)21/h4-5,12,15,17,21H,6-11,20H2,1-3H3/t15-,17+,19-/m1/s1 |
| InChIKey | TVRQAYXPSUAJDZ-HHXXYDBFSA-N |
| XLogP | 3.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |