C22H33NO — CID 177144216
(3aS,5aR,6S)-8-[(cyclopropylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol (PubChem CID 177144216) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (3aS,5aR,6S)-8-[(cyclopropylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol.
| Compound Name | (3aS,5aR,6S)-8-[(cyclopropylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
|---|---|
| PubChem CID | 177144216 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (3aS,5aR,6S)-8-[(cyclopropylamino)methyl]-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-6-ol |
| SMILES | CC(C)C1=C2C3=CC=C(CNC4CC4)C[C@H](O)[C@@H]3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H33NO/c1-14(2)17-8-10-22(3)11-9-18-19(21(17)22)7-4-15(12-20(18)24)13-23-16-5-6-16/h4,7,14,16,18,20,23-24H,5-6,8-13H2,1-3H3/t18-,20+,22-/m1/s1 |
| InChIKey | LLHOJKHFWYCARI-KAGYGMCKSA-N |
| XLogP | 4.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |