C18H33NO — CID 103277856
[1-(aminomethyl)-4-ethylcyclohexyl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 103277856) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is [1-(aminomethyl)-4-ethylcyclohexyl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol.
| Compound Name | [1-(aminomethyl)-4-ethylcyclohexyl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
|---|---|
| PubChem CID | 103277856 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | [1-(aminomethyl)-4-ethylcyclohexyl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CCC1CCC(CN)(C(O)C2CC(C)=CC(C)C2)CC1 |
| InChI | InChI=1S/C18H33NO/c1-4-15-5-7-18(12-19,8-6-15)17(20)16-10-13(2)9-14(3)11-16/h9,13,15-17,20H,4-8,10-12,19H2,1-3H3 |
| InChIKey | ARHMSUYGISPEEG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|