C17H31NO — CID 169490535
2-(aminomethyl)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentan-1-ol (PubChem CID 169490535) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 169490535 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2-(aminomethyl)-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CN)(CO)CC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C17H31NO/c1-12(2)8-17(10-18,11-19)9-13-5-6-14-7-15(13)16(14,3)4/h5,12,14-15,19H,6-11,18H2,1-4H3/t14-,15-,17?/m0/s1 |
| InChIKey | LHBSJDWUCRISNN-GIIGEWEBSA-N |
| XLogP | 3.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|