C34H69NO — CID 162385957
(12Z)-10-amino-8-butan-2-yl-4a,5,8,9-tetramethyl-1,2,3,4,5,6,7,9,10,11-decahydrobenzo[10]annulen-2-ol;ethane;3-ethyl-2-methylheptane (PubChem CID 162385957) has the molecular formula C34H69NO and a molecular weight of 507.93 g/mol. Its IUPAC name is (12Z)-10-amino-8-butan-2-yl-4a,5,8,9-tetramethyl-1,2,3,4,5,6,7,9,10,11-decahydrobenzo[10]annulen-2-ol;ethane;3-ethyl-2-methylheptane.
| Compound Name | (12Z)-10-amino-8-butan-2-yl-4a,5,8,9-tetramethyl-1,2,3,4,5,6,7,9,10,11-decahydrobenzo[10]annulen-2-ol;ethane;3-ethyl-2-methylheptane |
|---|---|
| PubChem CID | 162385957 |
| Molecular Formula | C34H69NO |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.54 |
| IUPAC Name | (12Z)-10-amino-8-butan-2-yl-4a,5,8,9-tetramethyl-1,2,3,4,5,6,7,9,10,11-decahydrobenzo[10]annulen-2-ol;ethane;3-ethyl-2-methylheptane |
| SMILES | CC.CCC(C)C1(C)CCC(C)C2(C)CCC(O)C/C2=C/CC(N)C1C.CCCCC(CC)C(C)C |
| InChI | InChI=1S/C22H41NO.C10H22.C2H6/c1-7-15(2)21(5)12-10-16(3)22(6)13-11-19(24)14-18(22)8-9-20(23)17(21)4;1-5-7-8-10(6-2)9(3)4;1-2/h8,15-17,19-20,24H,7,9-14,23H2,1-6H3;9-10H,5-8H2,1-4H3;1-2H3/b18-8-;; |
| InChIKey | MHFQNDZNRSYHTF-OHUGTHHSSA-N |
| XLogP | 10.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|