C22H41NO — CID 70325306
(1S)-1-[4-(butylaminomethyl)cyclohexyl]-3-(5-ethylcyclohexen-1-yl)propan-1-ol (PubChem CID 70325306) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is (1S)-1-[4-(butylaminomethyl)cyclohexyl]-3-(5-ethylcyclohexen-1-yl)propan-1-ol.
| Compound Name | (1S)-1-[4-(butylaminomethyl)cyclohexyl]-3-(5-ethylcyclohexen-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 70325306 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | (1S)-1-[4-(butylaminomethyl)cyclohexyl]-3-(5-ethylcyclohexen-1-yl)propan-1-ol |
| SMILES | CCCCNCC1CCC([C@@H](O)CCC2=CCCC(CC)C2)CC1 |
| InChI | InChI=1S/C22H41NO/c1-3-5-15-23-17-20-9-12-21(13-10-20)22(24)14-11-19-8-6-7-18(4-2)16-19/h8,18,20-24H,3-7,9-17H2,1-2H3/t18?,20?,21?,22-/m0/s1 |
| InChIKey | JISFKKOYANXTMF-OUHCFLCTSA-N |
| XLogP | 5.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|