C20H30N2O2 — CID 177144329
(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methylurea (PubChem CID 177144329) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methylurea.
| Compound Name | (6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methylurea |
|---|---|
| PubChem CID | 177144329 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methylurea |
| SMILES | CC(C)C1=C2C3=CC=C(CNC(N)=O)CC(O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-12(2)14-6-8-20(3)9-7-15-16(18(14)20)5-4-13(10-17(15)23)11-22-19(21)24/h4-5,12,15,17,23H,6-11H2,1-3H3,(H3,21,22,24) |
| InChIKey | XWQTXMGCYHBVGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |