C24H35NO2 — CID 177144273
N-[[(3aS,5aR,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl]methyl]cyclobutanecarboxamide (PubChem CID 177144273) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[[(3aS,5aR,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[(3aS,5aR,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 177144273 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | N-[[(3aS,5aR,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl]methyl]cyclobutanecarboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(CNC(=O)C4CCC4)C[C@H](O)[C@@H]3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C24H35NO2/c1-15(2)18-9-11-24(3)12-10-19-20(22(18)24)8-7-16(13-21(19)26)14-25-23(27)17-5-4-6-17/h7-8,15,17,19,21,26H,4-6,9-14H2,1-3H3,(H,25,27)/t19-,21+,24-/m1/s1 |
| InChIKey | ODSATAYPFUQITL-NHCICSSKSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |