C20H29NO2 — CID 177144222
6-hydroxy-N,3a-dimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide (PubChem CID 177144222) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 6-hydroxy-N,3a-dimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide.
| Compound Name | 6-hydroxy-N,3a-dimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
|---|---|
| PubChem CID | 177144222 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 6-hydroxy-N,3a-dimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
| SMILES | CNC(=O)C1=CC=C2C3=C(C(C)C)CCC3(C)CCC2C(O)C1 |
| InChI | InChI=1S/C20H29NO2/c1-12(2)14-7-9-20(3)10-8-15-16(18(14)20)6-5-13(11-17(15)22)19(23)21-4/h5-6,12,15,17,22H,7-11H2,1-4H3,(H,21,23) |
| InChIKey | BXHHOQSRMAYMSW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |