C21H31NO3 — CID 177144293
6-hydroxy-N-(2-hydroxyethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide (PubChem CID 177144293) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 6-hydroxy-N-(2-hydroxyethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide.
| Compound Name | 6-hydroxy-N-(2-hydroxyethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
|---|---|
| PubChem CID | 177144293 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 6-hydroxy-N-(2-hydroxyethyl)-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)NCCO)CC(O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C21H31NO3/c1-13(2)15-6-8-21(3)9-7-16-17(19(15)21)5-4-14(12-18(16)24)20(25)22-10-11-23/h4-5,13,16,18,23-24H,6-12H2,1-3H3,(H,22,25) |
| InChIKey | RKBSNJAZBURWTD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |