C30H53NO2 — CID 143858819
12-[(1Z,4Z)-deca-1,4-dienyl]-2-hydroxy-1,13-dimethyl-4-azabicyclo[9.4.0]pentadeca-11,14-dien-5-one;ethane (PubChem CID 143858819) has the molecular formula C30H53NO2 and a molecular weight of 459.76 g/mol. Its IUPAC name is 12-[(1Z,4Z)-deca-1,4-dienyl]-2-hydroxy-1,13-dimethyl-4-azabicyclo[9.4.0]pentadeca-11,14-dien-5-one;ethane.
| Compound Name | 12-[(1Z,4Z)-deca-1,4-dienyl]-2-hydroxy-1,13-dimethyl-4-azabicyclo[9.4.0]pentadeca-11,14-dien-5-one;ethane |
|---|---|
| PubChem CID | 143858819 |
| Molecular Formula | C30H53NO2 |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 459.41 |
| IUPAC Name | 12-[(1Z,4Z)-deca-1,4-dienyl]-2-hydroxy-1,13-dimethyl-4-azabicyclo[9.4.0]pentadeca-11,14-dien-5-one;ethane |
| SMILES | CC.CC.CCCCC/C=C\C/C=C\C1=C2CCCCCC(=O)NCC(O)C2(C)C=CC1C |
| InChI | InChI=1S/C26H41NO2.2C2H6/c1-4-5-6-7-8-9-10-12-15-22-21(2)18-19-26(3)23(22)16-13-11-14-17-25(29)27-20-24(26)28;2*1-2/h8-9,12,15,18-19,21,24,28H,4-7,10-11,13-14,16-17,20H2,1-3H3,(H,27,29);2*1-2H3/b9-8-,15-12-;; |
| InChIKey | CQEYWJUHELIUID-WXGHPXAKSA-N |
| XLogP | 8.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|