C39H78N2O2 — CID 54467729
(12R)-2-hexyl-N-[4-[2-(hexylamino)ethyl]heptyl]-12-hydroxyoctadec-9-enamide (PubChem CID 54467729) has the molecular formula C39H78N2O2 and a molecular weight of 607.07 g/mol. Its IUPAC name is (12R)-2-hexyl-N-[4-[2-(hexylamino)ethyl]heptyl]-12-hydroxyoctadec-9-enamide.
| Compound Name | (12R)-2-hexyl-N-[4-[2-(hexylamino)ethyl]heptyl]-12-hydroxyoctadec-9-enamide |
|---|---|
| PubChem CID | 54467729 |
| Molecular Formula | C39H78N2O2 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.61 |
| IUPAC Name | (12R)-2-hexyl-N-[4-[2-(hexylamino)ethyl]heptyl]-12-hydroxyoctadec-9-enamide |
| SMILES | CCCCCCNCCC(CCC)CCCNC(=O)C(CCCCCC)CCCCCCC=CC[C@H](O)CCCCCC |
| InChI | InChI=1S/C39H78N2O2/c1-5-9-12-20-28-37(29-21-18-16-15-17-19-23-31-38(42)30-22-13-10-6-2)39(43)41-34-25-27-36(26-8-4)32-35-40-33-24-14-11-7-3/h19,23,36-38,40,42H,5-18,20-22,24-35H2,1-4H3,(H,41,43)/t36?,37?,38-/m1/s1 |
| InChIKey | PQJYPJJYOANDRB-QYZZXKJTSA-N |
| XLogP | 11.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|