C30H51NO4 — CID 59916844
[(7S,8S,8aR)-8-[(5R)-7-(butylamino)-5-hydroxy-3-methyl-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 59916844) has the molecular formula C30H51NO4 and a molecular weight of 489.74 g/mol. Its IUPAC name is [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-5-hydroxy-3-methyl-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-5-hydroxy-3-methyl-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59916844 |
| Molecular Formula | C30H51NO4 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-5-hydroxy-3-methyl-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCNC(=O)C[C@H](O)CC(C)CC[C@@H]1[C@@H]2C(=CC(C)CC2OC(=O)C(C)(C)CC)C=C[C@@H]1C |
| InChI | InChI=1S/C30H51NO4/c1-8-10-15-31-27(33)19-24(32)17-20(3)11-14-25-22(5)12-13-23-16-21(4)18-26(28(23)25)35-29(34)30(6,7)9-2/h12-13,16,20-22,24-26,28,32H,8-11,14-15,17-19H2,1-7H3,(H,31,33)/t20?,21?,22-,24+,25-,26?,28-/m0/s1 |
| InChIKey | IHGQJBPLPXOIRQ-KXHRBYHASA-N |
| XLogP | 6.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|