C30H53N3O3 — CID 150400233
1-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150400233) has the molecular formula C30H53N3O3 and a molecular weight of 503.77 g/mol. Its IUPAC name is 1-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150400233 |
| Molecular Formula | C30H53N3O3 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.41 |
| IUPAC Name | 1-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C)=CC(C(N)=O)([C@H](CC2CCCCC2)[C@@H](O)CNCCC(C)C)C1 |
| InChI | InChI=1S/C30H53N3O3/c1-6-15-33(16-7-2)28(35)25-17-23(5)19-30(20-25,29(31)36)26(18-24-11-9-8-10-12-24)27(34)21-32-14-13-22(3)4/h17,19,22,24,26-27,32,34H,6-16,18,20-21H2,1-5H3,(H2,31,36)/t26-,27+,30?/m1/s1 |
| InChIKey | HDPWAHYIMZMNHW-QERCTFSXSA-N |
| XLogP | 4.97 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|