C30H52N4O4 — CID 150408517
5-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 150408517) has the molecular formula C30H52N4O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is 5-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 150408517 |
| Molecular Formula | C30H52N4O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | 5-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC(C(N)=O)=CC(C(N)=O)([C@H](CC2CCCCC2)[C@@H](O)CNCCC(C)C)C1 |
| InChI | InChI=1S/C30H52N4O4/c1-5-14-34(15-6-2)28(37)24-17-23(27(31)36)18-30(19-24,29(32)38)25(16-22-10-8-7-9-11-22)26(35)20-33-13-12-21(3)4/h17-18,21-22,25-26,33,35H,5-16,19-20H2,1-4H3,(H2,31,36)(H2,32,38)/t25-,26+,30?/m1/s1 |
| InChIKey | HFHFXLAHSHZQIF-UFZRHRTKSA-N |
| XLogP | 3.43 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|