C26H42N4O4 — CID 151615778
5-[(2R,3S)-2-hydroxy-1-(3-methylbutylamino)hex-5-yn-3-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 151615778) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 5-[(2R,3S)-2-hydroxy-1-(3-methylbutylamino)hex-5-yn-3-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-[(2R,3S)-2-hydroxy-1-(3-methylbutylamino)hex-5-yn-3-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 151615778 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 5-[(2R,3S)-2-hydroxy-1-(3-methylbutylamino)hex-5-yn-3-yl]-1-N,1-N-dipropylcyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | C#CC[C@H]([C@@H](O)CNCCC(C)C)C1(C(N)=O)C=C(C(N)=O)C=C(C(=O)N(CCC)CCC)C1 |
| InChI | InChI=1S/C26H42N4O4/c1-6-9-21(22(31)17-29-11-10-18(4)5)26(25(28)34)15-19(23(27)32)14-20(16-26)24(33)30(12-7-2)13-8-3/h1,14-15,18,21-22,29,31H,7-13,16-17H2,2-5H3,(H2,27,32)(H2,28,34)/t21-,22+,26?/m1/s1 |
| InChIKey | QNLRWLBLMPNEAI-SGNGHUOJSA-N |
| XLogP | 1.48 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|