C19H27NO2 — CID 177144302
(3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide (PubChem CID 177144302) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide.
| Compound Name | (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
|---|---|
| PubChem CID | 177144302 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(C(N)=O)C[C@H](O)C3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C19H27NO2/c1-11(2)13-6-8-19(3)9-7-14-15(17(13)19)5-4-12(18(20)22)10-16(14)21/h4-5,11,14,16,21H,6-10H2,1-3H3,(H2,20,22)/t14?,16-,19+/m0/s1 |
| InChIKey | FLNGMJNHGAJUAX-WHJCRDCLSA-N |
| XLogP | 3.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |