C21H31NO2 — CID 177144269
6-hydroxy-N,N,3a-trimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide (PubChem CID 177144269) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 6-hydroxy-N,N,3a-trimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide.
| Compound Name | 6-hydroxy-N,N,3a-trimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
|---|---|
| PubChem CID | 177144269 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 6-hydroxy-N,N,3a-trimethyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)N(C)C)CC(O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C21H31NO2/c1-13(2)15-8-10-21(3)11-9-16-17(19(15)21)7-6-14(12-18(16)23)20(24)22(4)5/h6-7,13,16,18,23H,8-12H2,1-5H3 |
| InChIKey | CXBGOOOEWMVQDA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |