C24H38N2O4 — CID 177146084
1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;methanol (PubChem CID 177146084) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;methanol.
| Compound Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;methanol |
|---|---|
| PubChem CID | 177146084 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;methanol |
| SMILES | CO.COc1ccc(CN(CC(=O)N2CCC[C@@H]3CCCC[C@@H]32)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C23H34N2O3.CH4O/c1-27-20-12-9-18(22(14-20)28-2)15-24(19-10-11-19)16-23(26)25-13-5-7-17-6-3-4-8-21(17)25;1-2/h9,12,14,17,19,21H,3-8,10-11,13,15-16H2,1-2H3;2H,1H3/t17-,21-;/m0./s1 |
| InChIKey | CYFXICSZPKKHNT-PVMVIUQGSA-N |
| XLogP | 3.46 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |