C26H41N3O3 — CID 177146134
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;azetidine (PubChem CID 177146134) has the molecular formula C26H41N3O3 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;azetidine.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;azetidine |
|---|---|
| PubChem CID | 177146134 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[cyclopropyl-[(2,4-dimethoxyphenyl)methyl]amino]ethanone;azetidine |
| SMILES | C1CNC1.COc1ccc(CN(CC(=O)N2CCCC3CCCCC32)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C23H34N2O3.C3H7N/c1-27-20-12-9-18(22(14-20)28-2)15-24(19-10-11-19)16-23(26)25-13-5-7-17-6-3-4-8-21(17)25;1-2-4-3-1/h9,12,14,17,19,21H,3-8,10-11,13,15-16H2,1-2H3;4H,1-3H2 |
| InChIKey | ULHGBVRGDGZZAR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |