C16H19N7 — CID 177147628
12-N-(2-imidazol-1-ylethyl)-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine (PubChem CID 177147628) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 12-N-(2-imidazol-1-ylethyl)-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine.
| Compound Name | 12-N-(2-imidazol-1-ylethyl)-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine |
|---|---|
| PubChem CID | 177147628 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 12-N-(2-imidazol-1-ylethyl)-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaene-10,12-diamine |
| SMILES | Cc1c2c(nc3nc(NCCn4ccnc4)nc(N)c13)CCC2 |
| InChI | InChI=1S/C16H19N7/c1-10-11-3-2-4-12(11)20-15-13(10)14(17)21-16(22-15)19-6-8-23-7-5-18-9-23/h5,7,9H,2-4,6,8H2,1H3,(H3,17,19,20,21,22) |
| InChIKey | YUPUWLJAVOLQEC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |