C13H12F4N6O — CID 177147967
N-[6-[(E)-aminomethylideneamino]-5-fluoro-3-pyridinyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 177147967) has the molecular formula C13H12F4N6O and a molecular weight of 344.27 g/mol. Its IUPAC name is N-[6-[(E)-aminomethylideneamino]-5-fluoro-3-pyridinyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[6-[(E)-aminomethylideneamino]-5-fluoro-3-pyridinyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 177147967 |
| Molecular Formula | C13H12F4N6O |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[6-[(E)-aminomethylideneamino]-5-fluoro-3-pyridinyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)Nc1cnc(/N=C/N)c(F)c1 |
| InChI | InChI=1S/C13H12F4N6O/c1-7-2-10(13(15,16)17)22-23(7)5-11(24)21-8-3-9(14)12(19-4-8)20-6-18/h2-4,6H,5H2,1H3,(H,21,24)(H2,18,19,20) |
| InChIKey | SZEIWZFLNBCVOH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|