C27H23F8NO2 — CID 177150379
2,6-difluoro-N-(2-methoxyprop-2-enyl)benzamide;1-[(3-methylphenyl)methyl]-2,4-bis(trifluoromethyl)benzene (PubChem CID 177150379) has the molecular formula C27H23F8NO2 and a molecular weight of 545.47 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-methoxyprop-2-enyl)benzamide;1-[(3-methylphenyl)methyl]-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 2,6-difluoro-N-(2-methoxyprop-2-enyl)benzamide;1-[(3-methylphenyl)methyl]-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 177150379 |
| Molecular Formula | C27H23F8NO2 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 2,6-difluoro-N-(2-methoxyprop-2-enyl)benzamide;1-[(3-methylphenyl)methyl]-2,4-bis(trifluoromethyl)benzene |
| SMILES | C=C(CNC(=O)c1c(F)cccc1F)OC.Cc1cccc(Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6.C11H11F2NO2/c1-10-3-2-4-11(7-10)8-12-5-6-13(15(17,18)19)9-14(12)16(20,21)22;1-7(16-2)6-14-11(15)10-8(12)4-3-5-9(10)13/h2-7,9H,8H2,1H3;3-5H,1,6H2,2H3,(H,14,15) |
| InChIKey | PITIUAFOEHBDCI-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|