About butane;1-butylpiperidin-4-one
butane;1-butylpiperidin-4-one (PubChem CID 177152756) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is butane;1-butylpiperidin-4-one.
Molecular Properties
| Compound Name | butane;1-butylpiperidin-4-one |
| PubChem CID | 177152756 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | butane;1-butylpiperidin-4-one |
| SMILES | CCCC.CCCCN1CCC(=O)CC1 |
| InChI | InChI=1S/C9H17NO.C4H10/c1-2-3-6-10-7-4-9(11)5-8-10;1-3-4-2/h2-8H2,1H3;3-4H2,1-2H3 |
| InChIKey | KQAKFQDNCUIIKR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;1-butylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-butylpiperidin-4-one?
The IUPAC name of butane;1-butylpiperidin-4-one (CID 177152756) is butane;1-butylpiperidin-4-one.
What is the SMILES notation for butane;1-butylpiperidin-4-one?
The canonical SMILES for butane;1-butylpiperidin-4-one is CCCC.CCCCN1CCC(=O)CC1.
What is the InChIKey of butane;1-butylpiperidin-4-one?
The InChIKey is KQAKFQDNCUIIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C4H10/c1-2-3-6-10-7-4-9(11)5-8-10;1-3-4-2/h2-8H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;1-butylpiperidin-4-one?
butane;1-butylpiperidin-4-one has a molecular weight of 213.36 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-butylpiperidin-4-one is sourced from PubChem (CID 177152756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).