About 1-octylpiperidin-3-one;1-octylpiperidin-4-one
1-octylpiperidin-3-one;1-octylpiperidin-4-one (PubChem CID 68829117) has the molecular formula C26H50N2O2
and a molecular weight of 422.70 g/mol. Its IUPAC name is 1-octylpiperidin-3-one;1-octylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-octylpiperidin-3-one;1-octylpiperidin-4-one |
| PubChem CID | 68829117 |
| Molecular Formula | C26H50N2O2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | 1-octylpiperidin-3-one;1-octylpiperidin-4-one |
| SMILES | CCCCCCCCN1CCC(=O)CC1.CCCCCCCCN1CCCC(=O)C1 |
| InChI | InChI=1S/2C13H25NO/c1-2-3-4-5-6-7-10-14-11-8-13(15)9-12-14;1-2-3-4-5-6-7-10-14-11-8-9-13(15)12-14/h2*2-12H2,1H3 |
| InChIKey | QRIJPOFOFOQGOD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octylpiperidin-3-one;1-octylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylpiperidin-3-one;1-octylpiperidin-4-one?
The IUPAC name of 1-octylpiperidin-3-one;1-octylpiperidin-4-one (CID 68829117) is 1-octylpiperidin-3-one;1-octylpiperidin-4-one.
What is the SMILES notation for 1-octylpiperidin-3-one;1-octylpiperidin-4-one?
The canonical SMILES for 1-octylpiperidin-3-one;1-octylpiperidin-4-one is CCCCCCCCN1CCC(=O)CC1.CCCCCCCCN1CCCC(=O)C1.
What is the InChIKey of 1-octylpiperidin-3-one;1-octylpiperidin-4-one?
The InChIKey is QRIJPOFOFOQGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H25NO/c1-2-3-4-5-6-7-10-14-11-8-13(15)9-12-14;1-2-3-4-5-6-7-10-14-11-8-9-13(15)12-14/h2*2-12H2,1H3.
What are the key properties of 1-octylpiperidin-3-one;1-octylpiperidin-4-one?
1-octylpiperidin-3-one;1-octylpiperidin-4-one has a molecular weight of 422.70 g/mol, XLogP of 6.02, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylpiperidin-3-one;1-octylpiperidin-4-one is sourced from PubChem (CID 68829117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).