C12H16O3 — CID 177152868
4-butanoyl-3-methoxy-5-methylcyclohexa-2,5-dien-1-one (PubChem CID 177152868) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-butanoyl-3-methoxy-5-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-butanoyl-3-methoxy-5-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 177152868 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-butanoyl-3-methoxy-5-methylcyclohexa-2,5-dien-1-one |
| SMILES | CCCC(=O)C1C(C)=CC(=O)C=C1OC |
| InChI | InChI=1S/C12H16O3/c1-4-5-10(14)12-8(2)6-9(13)7-11(12)15-3/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | VEIABFUIROCPPO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |