C24H26BrN3O4 — CID 177154158
ethyl 2-[[8-bromo-4-phenylmethoxy-2-(propan-2-ylideneamino)-1H-isoquinoline-3-carbonyl]amino]acetate (PubChem CID 177154158) has the molecular formula C24H26BrN3O4 and a molecular weight of 500.39 g/mol. Its IUPAC name is ethyl 2-[[8-bromo-4-phenylmethoxy-2-(propan-2-ylideneamino)-1H-isoquinoline-3-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[8-bromo-4-phenylmethoxy-2-(propan-2-ylideneamino)-1H-isoquinoline-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 177154158 |
| Molecular Formula | C24H26BrN3O4 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | ethyl 2-[[8-bromo-4-phenylmethoxy-2-(propan-2-ylideneamino)-1H-isoquinoline-3-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1=C(OCc2ccccc2)c2cccc(Br)c2CN1N=C(C)C |
| InChI | InChI=1S/C24H26BrN3O4/c1-4-31-21(29)13-26-24(30)22-23(32-15-17-9-6-5-7-10-17)18-11-8-12-20(25)19(18)14-28(22)27-16(2)3/h5-12H,4,13-15H2,1-3H3,(H,26,30) |
| InChIKey | GMEAHAHXBSKSFN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|