C11H23NO — CID 177155812
N-(2,6-dimethylheptan-4-yl)acetamide (PubChem CID 177155812) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-yl)acetamide.
| Compound Name | N-(2,6-dimethylheptan-4-yl)acetamide |
|---|---|
| PubChem CID | 177155812 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | N-(2,6-dimethylheptan-4-yl)acetamide |
| SMILES | CC(=O)NC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H23NO/c1-8(2)6-11(7-9(3)4)12-10(5)13/h8-9,11H,6-7H2,1-5H3,(H,12,13) |
| InChIKey | WBSWOLQCXCVDOL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |