C15H23BrN4O2 — CID 177155849
1-[4-bromo-2-(methylamino)benzenecarboximidoyl]-3-methyl-1-(3-oxopropyl)urea;ethane (PubChem CID 177155849) has the molecular formula C15H23BrN4O2 and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[4-bromo-2-(methylamino)benzenecarboximidoyl]-3-methyl-1-(3-oxopropyl)urea;ethane.
| Compound Name | 1-[4-bromo-2-(methylamino)benzenecarboximidoyl]-3-methyl-1-(3-oxopropyl)urea;ethane |
|---|---|
| PubChem CID | 177155849 |
| Molecular Formula | C15H23BrN4O2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[4-bromo-2-(methylamino)benzenecarboximidoyl]-3-methyl-1-(3-oxopropyl)urea;ethane |
| SMILES | CC.[H]/N=C(/c1ccc(Br)cc1NC)N(CCC=O)C(=O)NC |
| InChI | InChI=1S/C13H17BrN4O2.C2H6/c1-16-11-8-9(14)4-5-10(11)12(15)18(6-3-7-19)13(20)17-2;1-2/h4-5,7-8,15-16H,3,6H2,1-2H3,(H,17,20);1-2H3/b15-12-; |
| InChIKey | DYVKPLFBPPVTSJ-OBBOLZQKSA-N |
| XLogP | 3.07 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|