C33H41N8O+ — CID 177157812
3-(4-phenoxyphenyl)-1-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]cyclohexylidene]pyrazolo[3,4-d]pyrimidin-1-ium-4-amine (PubChem CID 177157812) has the molecular formula C33H41N8O+ and a molecular weight of 565.75 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]cyclohexylidene]pyrazolo[3,4-d]pyrimidin-1-ium-4-amine.
| Compound Name | 3-(4-phenoxyphenyl)-1-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]cyclohexylidene]pyrazolo[3,4-d]pyrimidin-1-ium-4-amine |
|---|---|
| PubChem CID | 177157812 |
| Molecular Formula | C33H41N8O+ |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]cyclohexylidene]pyrazolo[3,4-d]pyrimidin-1-ium-4-amine |
| SMILES | Nc1ncnc2c1C(c1ccc(Oc3ccccc3)cc1)=N[N+]2=C1CCC(N2CCN(CC3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C33H41N8O/c34-32-30-31(25-6-12-29(13-7-25)42-28-4-2-1-3-5-28)38-41(33(30)37-23-36-32)27-10-8-26(9-11-27)40-20-18-39(19-21-40)22-24-14-16-35-17-15-24/h1-7,12-13,23-24,26,35H,8-11,14-22H2,(H2,34,36,37)/q+1/b41-27- |
| InChIKey | LQPTYCYLGVLGTE-CBALNBDPSA-N |
| XLogP | 4.26 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|