C26H36N4O3S — CID 177159759
3-[2-(4-aminosulfanyl-2-methylphenyl)ethyl]-7-morpholin-4-yl-2-propan-2-ylquinazolin-4-one;methoxymethane (PubChem CID 177159759) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 3-[2-(4-aminosulfanyl-2-methylphenyl)ethyl]-7-morpholin-4-yl-2-propan-2-ylquinazolin-4-one;methoxymethane.
| Compound Name | 3-[2-(4-aminosulfanyl-2-methylphenyl)ethyl]-7-morpholin-4-yl-2-propan-2-ylquinazolin-4-one;methoxymethane |
|---|---|
| PubChem CID | 177159759 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-[2-(4-aminosulfanyl-2-methylphenyl)ethyl]-7-morpholin-4-yl-2-propan-2-ylquinazolin-4-one;methoxymethane |
| SMILES | COC.Cc1cc(SN)ccc1CCn1c(C(C)C)nc2cc(N3CCOCC3)ccc2c1=O |
| InChI | InChI=1S/C24H30N4O2S.C2H6O/c1-16(2)23-26-22-15-19(27-10-12-30-13-11-27)5-7-21(22)24(29)28(23)9-8-18-4-6-20(31-25)14-17(18)3;1-3-2/h4-7,14-16H,8-13,25H2,1-3H3;1-2H3 |
| InChIKey | WYNGQPSBHJYGDE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|