C26H27N4O2P — CID 135268596
1-methyl-6-[[2-methyl-5-(7-morpholin-4-ylquinazolin-4-yl)-4-phosphanylphenyl]methyl]pyridin-2-one (PubChem CID 135268596) has the molecular formula C26H27N4O2P and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-methyl-6-[[2-methyl-5-(7-morpholin-4-ylquinazolin-4-yl)-4-phosphanylphenyl]methyl]pyridin-2-one.
| Compound Name | 1-methyl-6-[[2-methyl-5-(7-morpholin-4-ylquinazolin-4-yl)-4-phosphanylphenyl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 135268596 |
| Molecular Formula | C26H27N4O2P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-methyl-6-[[2-methyl-5-(7-morpholin-4-ylquinazolin-4-yl)-4-phosphanylphenyl]methyl]pyridin-2-one |
| SMILES | Cc1cc(P)c(-c2ncnc3cc(N4CCOCC4)ccc23)cc1Cc1cccc(=O)n1C |
| InChI | InChI=1S/C26H27N4O2P/c1-17-12-24(33)22(14-18(17)13-19-4-3-5-25(31)29(19)2)26-21-7-6-20(15-23(21)27-16-28-26)30-8-10-32-11-9-30/h3-7,12,14-16H,8-11,13,33H2,1-2H3 |
| InChIKey | LQVOAQNBKUEHKL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|