C25H24FN5O2 — CID 118954815
4-[4-[2-fluoro-5-[methoxy-(3-methylpyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine (PubChem CID 118954815) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[4-[2-fluoro-5-[methoxy-(3-methylpyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine.
| Compound Name | 4-[4-[2-fluoro-5-[methoxy-(3-methylpyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine |
|---|---|
| PubChem CID | 118954815 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[4-[2-fluoro-5-[methoxy-(3-methylpyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine |
| SMILES | COC(c1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1)c1nccnc1C |
| InChI | InChI=1S/C25H24FN5O2/c1-16-23(28-8-7-27-16)25(32-2)17-3-6-21(26)20(13-17)24-19-5-4-18(14-22(19)29-15-30-24)31-9-11-33-12-10-31/h3-8,13-15,25H,9-12H2,1-2H3 |
| InChIKey | VJZQQSPYGNVLNF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |