C24H22FN5O3 — CID 118954974
[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(4-methoxypyridazin-3-yl)methanol (PubChem CID 118954974) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is [4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(4-methoxypyridazin-3-yl)methanol.
| Compound Name | [4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(4-methoxypyridazin-3-yl)methanol |
|---|---|
| PubChem CID | 118954974 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(4-methoxypyridazin-3-yl)methanol |
| SMILES | COc1ccnnc1C(O)c1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1 |
| InChI | InChI=1S/C24H22FN5O3/c1-32-21-6-7-28-29-23(21)24(31)15-2-5-19(25)18(12-15)22-17-4-3-16(13-20(17)26-14-27-22)30-8-10-33-11-9-30/h2-7,12-14,24,31H,8-11H2,1H3 |
| InChIKey | CYGVNIZYJOHEKW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |