C24H22FN5O2 — CID 144744787
4-[4-[2-fluoro-5-[(3-methoxypyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine (PubChem CID 144744787) has the molecular formula C24H22FN5O2 and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[4-[2-fluoro-5-[(3-methoxypyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine.
| Compound Name | 4-[4-[2-fluoro-5-[(3-methoxypyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine |
|---|---|
| PubChem CID | 144744787 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-[4-[2-fluoro-5-[(3-methoxypyrazin-2-yl)methyl]phenyl]quinazolin-7-yl]morpholine |
| SMILES | COc1nccnc1Cc1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1 |
| InChI | InChI=1S/C24H22FN5O2/c1-31-24-22(26-6-7-27-24)13-16-2-5-20(25)19(12-16)23-18-4-3-17(14-21(18)28-15-29-23)30-8-10-32-11-9-30/h2-7,12,14-15H,8-11,13H2,1H3 |
| InChIKey | ZTFUNMZCLUANAG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |