C26H19F3N4O — CID 123743146
4-[4-[5-[1-(3,5-difluoro-4-pyridinyl)prop-2-ynyl]-2-fluorophenyl]quinazolin-7-yl]morpholine (PubChem CID 123743146) has the molecular formula C26H19F3N4O and a molecular weight of 460.46 g/mol. Its IUPAC name is 4-[4-[5-[1-(3,5-difluoro-4-pyridinyl)prop-2-ynyl]-2-fluorophenyl]quinazolin-7-yl]morpholine.
| Compound Name | 4-[4-[5-[1-(3,5-difluoro-4-pyridinyl)prop-2-ynyl]-2-fluorophenyl]quinazolin-7-yl]morpholine |
|---|---|
| PubChem CID | 123743146 |
| Molecular Formula | C26H19F3N4O |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-[4-[5-[1-(3,5-difluoro-4-pyridinyl)prop-2-ynyl]-2-fluorophenyl]quinazolin-7-yl]morpholine |
| SMILES | C#CC(c1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1)c1c(F)cncc1F |
| InChI | InChI=1S/C26H19F3N4O/c1-2-18(25-22(28)13-30-14-23(25)29)16-3-6-21(27)20(11-16)26-19-5-4-17(12-24(19)31-15-32-26)33-7-9-34-10-8-33/h1,3-6,11-15,18H,7-10H2 |
| InChIKey | RQHMFXDMJNKFQC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|