C28H33FN4O2 — CID 144744887
ethane;(2E,4Z)-1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2,3-dimethyl-5-(methylideneamino)penta-2,4-dien-1-ol (PubChem CID 144744887) has the molecular formula C28H33FN4O2 and a molecular weight of 476.60 g/mol. Its IUPAC name is ethane;(2E,4Z)-1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2,3-dimethyl-5-(methylideneamino)penta-2,4-dien-1-ol.
| Compound Name | ethane;(2E,4Z)-1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2,3-dimethyl-5-(methylideneamino)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144744887 |
| Molecular Formula | C28H33FN4O2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | ethane;(2E,4Z)-1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2,3-dimethyl-5-(methylideneamino)penta-2,4-dien-1-ol |
| SMILES | C=N/C=C\C(C)=C(/C)C(O)c1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1.CC |
| InChI | InChI=1S/C26H27FN4O2.C2H6/c1-17(8-9-28-3)18(2)26(32)19-4-7-23(27)22(14-19)25-21-6-5-20(15-24(21)29-16-30-25)31-10-12-33-13-11-31;1-2/h4-9,14-16,26,32H,3,10-13H2,1-2H3;1-2H3/b9-8-,18-17+; |
| InChIKey | QLHONUVAYFXODI-VWHOLGFZSA-N |
| XLogP | 5.88 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|