C26H27FN4O4 — CID 137288877
5-fluoro-2-[(2E,4E)-1-hydroxy-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienyl]-4-(7-morpholin-4-ylquinazolin-4-yl)phenol (PubChem CID 137288877) has the molecular formula C26H27FN4O4 and a molecular weight of 478.52 g/mol. Its IUPAC name is 5-fluoro-2-[(2E,4E)-1-hydroxy-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienyl]-4-(7-morpholin-4-ylquinazolin-4-yl)phenol.
| Compound Name | 5-fluoro-2-[(2E,4E)-1-hydroxy-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienyl]-4-(7-morpholin-4-ylquinazolin-4-yl)phenol |
|---|---|
| PubChem CID | 137288877 |
| Molecular Formula | C26H27FN4O4 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-fluoro-2-[(2E,4E)-1-hydroxy-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienyl]-4-(7-morpholin-4-ylquinazolin-4-yl)phenol |
| SMILES | C=N/C(=C\C=C(/C)C(O)c1cc(-c2ncnc3cc(N4CCOCC4)ccc23)c(F)cc1O)OC |
| InChI | InChI=1S/C26H27FN4O4/c1-16(4-7-24(28-2)34-3)26(33)20-13-19(21(27)14-23(20)32)25-18-6-5-17(12-22(18)29-15-30-25)31-8-10-35-11-9-31/h4-7,12-15,26,32-33H,2,8-11H2,1,3H3/b16-4+,24-7+ |
| InChIKey | BFSSHSYFFNOZLH-YBKLPHRPSA-N |
| XLogP | 4.15 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|