C29H35FN4O2 — CID 144744910
N-[1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-3-methylbut-2-en-2-yl]prop-2-en-1-imine;propan-1-ol (PubChem CID 144744910) has the molecular formula C29H35FN4O2 and a molecular weight of 490.62 g/mol. Its IUPAC name is N-[1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-3-methylbut-2-en-2-yl]prop-2-en-1-imine;propan-1-ol.
| Compound Name | N-[1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-3-methylbut-2-en-2-yl]prop-2-en-1-imine;propan-1-ol |
|---|---|
| PubChem CID | 144744910 |
| Molecular Formula | C29H35FN4O2 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | N-[1-[4-fluoro-3-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-3-methylbut-2-en-2-yl]prop-2-en-1-imine;propan-1-ol |
| SMILES | C=C/C=N/C(Cc1ccc(F)c(-c2ncnc3cc(N4CCOCC4)ccc23)c1)=C(C)C.CCCO |
| InChI | InChI=1S/C26H27FN4O.C3H8O/c1-4-9-28-24(18(2)3)15-19-5-8-23(27)22(14-19)26-21-7-6-20(16-25(21)29-17-30-26)31-10-12-32-13-11-31;1-2-3-4/h4-9,14,16-17H,1,10-13,15H2,2-3H3;4H,2-3H2,1H3/b28-9+; |
| InChIKey | RYFBCYSTDROJJK-HEMFYBCTSA-N |
| XLogP | 5.75 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|