C12H21NO — CID 177161814
(2R)-2,3,4,8-tetramethyl-1-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 177161814) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2R)-2,3,4,8-tetramethyl-1-oxa-8-azaspiro[4.5]dec-3-ene.
| Compound Name | (2R)-2,3,4,8-tetramethyl-1-oxa-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 177161814 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2R)-2,3,4,8-tetramethyl-1-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC1=C(C)C2(CCN(C)CC2)O[C@@H]1C |
| InChI | InChI=1S/C12H21NO/c1-9-10(2)12(14-11(9)3)5-7-13(4)8-6-12/h11H,5-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | TXIYVRCGUIFOQX-LLVKDONJSA-N |
| XLogP | 2.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|