C17H36NP — CID 177162678
ethane;(2,3,9-trimethyl-9-azaspiro[4.6]undec-3-en-4-yl)phosphane (PubChem CID 177162678) has the molecular formula C17H36NP and a molecular weight of 285.46 g/mol. Its IUPAC name is ethane;(2,3,9-trimethyl-9-azaspiro[4.6]undec-3-en-4-yl)phosphane.
| Compound Name | ethane;(2,3,9-trimethyl-9-azaspiro[4.6]undec-3-en-4-yl)phosphane |
|---|---|
| PubChem CID | 177162678 |
| Molecular Formula | C17H36NP |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | ethane;(2,3,9-trimethyl-9-azaspiro[4.6]undec-3-en-4-yl)phosphane |
| SMILES | CC.CC.CC1=C(P)C2(CCCN(C)CC2)CC1C |
| InChI | InChI=1S/C13H24NP.2C2H6/c1-10-9-13(12(15)11(10)2)5-4-7-14(3)8-6-13;2*1-2/h10H,4-9,15H2,1-3H3;2*1-2H3 |
| InChIKey | OOLSVSCANBIRPY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|