C18H35N — CID 177162070
4,9-dimethyl-5-propan-2-yl-9-azaspiro[5.6]dodec-4-ene;ethane (PubChem CID 177162070) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 4,9-dimethyl-5-propan-2-yl-9-azaspiro[5.6]dodec-4-ene;ethane.
| Compound Name | 4,9-dimethyl-5-propan-2-yl-9-azaspiro[5.6]dodec-4-ene;ethane |
|---|---|
| PubChem CID | 177162070 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 4,9-dimethyl-5-propan-2-yl-9-azaspiro[5.6]dodec-4-ene;ethane |
| SMILES | CC.CC1=C(C(C)C)C2(CCC1)CCCN(C)CC2 |
| InChI | InChI=1S/C16H29N.C2H6/c1-13(2)15-14(3)7-5-8-16(15)9-6-11-17(4)12-10-16;1-2/h13H,5-12H2,1-4H3;1-2H3 |
| InChIKey | VUCBLQDWLIWEPR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|