About 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid
5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid (PubChem CID 177163771) has the molecular formula C12H19N2O2+
and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid |
| PubChem CID | 177163771 |
| Molecular Formula | C12H19N2O2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid |
| SMILES | Cc1cc(C)[n+](C)c(CCCCC(=O)O)n1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-8-10(2)14(3)11(13-9)6-4-5-7-12(15)16/h8H,4-7H2,1-3H3/p+1 |
| InChIKey | ONVRZANLZXCBCD-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid?
The IUPAC name of 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid (CID 177163771) is 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid.
What is the SMILES notation for 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid?
The canonical SMILES for 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid is Cc1cc(C)[n+](C)c(CCCCC(=O)O)n1.
What is the InChIKey of 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid?
The InChIKey is ONVRZANLZXCBCD-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H18N2O2/c1-9-8-10(2)14(3)11(13-9)6-4-5-7-12(15)16/h8H,4-7H2,1-3H3/p+1.
What are the key properties of 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid?
5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid has a molecular weight of 223.30 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4,6-trimethylpyrimidin-1-ium-2-yl)pentanoic acid is sourced from PubChem (CID 177163771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).