C12H8F2OS — CID 177164297
4-(2,4-difluorophenyl)sulfanylphenol (PubChem CID 177164297) has the molecular formula C12H8F2OS and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanylphenol.
| Compound Name | 4-(2,4-difluorophenyl)sulfanylphenol |
|---|---|
| PubChem CID | 177164297 |
| Molecular Formula | C12H8F2OS |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanylphenol |
| SMILES | Oc1ccc(Sc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C12H8F2OS/c13-8-1-6-12(11(14)7-8)16-10-4-2-9(15)3-5-10/h1-7,15H |
| InChIKey | AYUAEAYFQAVKLL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |