C13H12F2N2S — CID 83123417
(1R)-1-[5-(2,4-difluorophenyl)sulfanyl-2-pyridinyl]ethanamine (PubChem CID 83123417) has the molecular formula C13H12F2N2S and a molecular weight of 266.32 g/mol. Its IUPAC name is (1R)-1-[5-(2,4-difluorophenyl)sulfanyl-2-pyridinyl]ethanamine.
| Compound Name | (1R)-1-[5-(2,4-difluorophenyl)sulfanyl-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 83123417 |
| Molecular Formula | C13H12F2N2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (1R)-1-[5-(2,4-difluorophenyl)sulfanyl-2-pyridinyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Sc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C13H12F2N2S/c1-8(16)12-4-3-10(7-17-12)18-13-5-2-9(14)6-11(13)15/h2-8H,16H2,1H3/t8-/m1/s1 |
| InChIKey | BHSOPUMIZBJMGA-MRVPVSSYSA-N |
| XLogP | 3.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |