C10H17NO2 — CID 177165872
N-(2-methoxyethyl)cyclohexa-1,5-diene-1-carboxamide;molecular hydrogen (PubChem CID 177165872) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)cyclohexa-1,5-diene-1-carboxamide;molecular hydrogen.
| Compound Name | N-(2-methoxyethyl)cyclohexa-1,5-diene-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 177165872 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-(2-methoxyethyl)cyclohexa-1,5-diene-1-carboxamide;molecular hydrogen |
| SMILES | COCCNC(=O)C1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C10H15NO2.H2/c1-13-8-7-11-10(12)9-5-3-2-4-6-9;/h3,5-6H,2,4,7-8H2,1H3,(H,11,12);1H |
| InChIKey | GMOHTOHXMQKYEH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|