C22H17F3N4O5S — CID 177166055
(5Z)-2-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 177166055) has the molecular formula C22H17F3N4O5S and a molecular weight of 506.46 g/mol. Its IUPAC name is (5Z)-2-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-2-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 177166055 |
| Molecular Formula | C22H17F3N4O5S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | (5Z)-2-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1cc(CCc2nc3s/c(=C\c4ccc(C(F)(F)F)cc4)c(=O)n3n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H17F3N4O5S/c1-33-16-10-13(15(29(31)32)11-17(16)34-2)5-8-19-26-21-28(27-19)20(30)18(35-21)9-12-3-6-14(7-4-12)22(23,24)25/h3-4,6-7,9-11H,5,8H2,1-2H3/b18-9- |
| InChIKey | IGSMJQLPDBUSOI-NVMNQCDNSA-N |
| XLogP | 3.43 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|